Difference between revisions of "PROTOPORPHYRIN IX"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * inchi-key: ** sbjkkffyizucet-sz...") |
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRIN_IX == * common-name: ** protoporphyrin ix * smiles: ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PROTOPORPHYRIN_IX == |
* common-name: | * common-name: | ||
− | ** | + | ** protoporphyrin ix |
* smiles: | * smiles: | ||
− | ** c( | + | ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5))) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ksfovussgskxfi-ujjxfscmsa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 560.651 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[PROTOHEMEFERROCHELAT-RXN]] |
− | * [[ | + | * [[RXN1F-20]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PPPGO]] |
− | + | * [[PROTOHEMEFERROCHELAT-RXN]] | |
− | + | * [[PROTOPORGENOXI-RXN]] | |
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=protoporphyrin ix}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=560.651}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite PROTOPORPHYRIN_IX
- common-name:
- protoporphyrin ix
- smiles:
- c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
- inchi-key:
- ksfovussgskxfi-ujjxfscmsa-l
- molecular-weight:
- 560.651