Difference between revisions of "PROTOPORPHYRIN IX"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-DEHYDRO-ASCORBATE == * common-name: ** l-dehydro-ascorbate * smiles: ** c(o)c(o)c1(c(=o)c(=o)c(=o)o1) * inchi-key: ** sbjkkffyizucet-sz...")
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRIN_IX == * common-name: ** protoporphyrin ix * smiles: ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-DEHYDRO-ASCORBATE ==
+
== Metabolite PROTOPORPHYRIN_IX ==
 
* common-name:
 
* common-name:
** l-dehydro-ascorbate
+
** protoporphyrin ix
 
* smiles:
 
* smiles:
** c(o)c(o)c1(c(=o)c(=o)c(=o)o1)
+
** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
 
* inchi-key:
 
* inchi-key:
** sbjkkffyizucet-szscbosdsa-n
+
** ksfovussgskxfi-ujjxfscmsa-l
 
* molecular-weight:
 
* molecular-weight:
** 174.11
+
** 560.651
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.8.5.1-RXN]]
+
* [[PROTOHEMEFERROCHELAT-RXN]]
* [[RXN-13185]]
+
* [[RXN1F-20]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
+
* [[PPPGO]]
* [[ETHYL-RXN]]
+
* [[PROTOHEMEFERROCHELAT-RXN]]
* [[RXN-12440]]
+
* [[PROTOPORGENOXI-RXN]]
* [[RXN-13185]]
 
* [[RXN-19200]]
 
* [[RXN-7984]]
 
* [[RXN-7985]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-dehydro-ascorbate}}
+
{{#set: common-name=protoporphyrin ix}}
{{#set: inchi-key=inchikey=sbjkkffyizucet-szscbosdsa-n}}
+
{{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}}
{{#set: molecular-weight=174.11}}
+
{{#set: molecular-weight=560.651}}

Latest revision as of 11:12, 18 March 2021

Metabolite PROTOPORPHYRIN_IX

  • common-name:
    • protoporphyrin ix
  • smiles:
    • c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
  • inchi-key:
    • ksfovussgskxfi-ujjxfscmsa-l
  • molecular-weight:
    • 560.651

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality