Difference between revisions of "PROUT-PWY"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] ==
+== Pathway PROUT-PWY ==
+* taxonomic-range:
+** tax-2759
+** tax-2157
+** tax-2
 * common-name:
-** l-cysteinyl-glycine
+** l-proline degradation
-* smiles:
+== Reaction(s) found ==
-** c(c([o-])=o)nc(c(cs)[n+])=o
+* [[RXN-14116]]
-* inchi-key:
+* [[RXN-14903]]
-** zukpvrwzdmrieo-vkhmyheasa-n
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneSPONTPRO-RXN SPONTPRO-RXN]
-** 178.206
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=l-proline degradation}}
-* [[RXN-6622]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.67}}
-* [[RXN-12618]]
+{{#set: nb total reaction=3}}
-* [[RXN-18092]]
-* [[RXN-6601]]
-* [[RXN-9157]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=l-cysteinyl-glycine}}
-{{#set: inchi-key=inchikey=zukpvrwzdmrieo-vkhmyheasa-n}}
-{{#set: molecular-weight=178.206}}