Difference between revisions of "PRPP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11939 == * common-name: ** 3,5-bisdiphosphoinositol-1d-myo-inositol 2,3,4,6-tetrakisphosphate * smiles: ** c1(op([o-])([o-])=o)(c(op(...") |
(Created page with "Category:metabolite == Metabolite CPD-14115 == * common-name: ** (s)-equol * smiles: ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) * inchi-key: ** adfcqwzhkcxpaj-gfccveg...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-14115 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-equol |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** adfcqwzhkcxpaj-gfccvegcsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 242.274 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15589]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15589]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-equol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=adfcqwzhkcxpaj-gfccvegcsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=242.274}} |
Revision as of 14:57, 5 January 2021
Contents
Metabolite CPD-14115
- common-name:
- (s)-equol
- smiles:
- c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o)
- inchi-key:
- adfcqwzhkcxpaj-gfccvegcsa-n
- molecular-weight:
- 242.274
