Difference between revisions of "PRPP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16897 == * transcription-direction: ** negative * right-end-position: ** 67856 * left-end-position: ** 57781 * centisome-position: ** 20.95861...")
(Created page with "Category:metabolite == Metabolite PRPP == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * smiles: ** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ16897 ==
+
== Metabolite PRPP ==
* transcription-direction:
+
* common-name:
** negative
+
** 5-phospho-α-d-ribose 1-diphosphate
* right-end-position:
+
* smiles:
** 67856
+
** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
* left-end-position:
+
* inchi-key:
** 57781
+
** pqgcedqwhsbajp-txicztdvsa-i
* centisome-position:
+
* molecular-weight:
** 20.95861   
+
** 385.031
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ADENPRIBOSYLTRAN-RXN]]
== Reaction(s) associated ==
+
* [[ADPART]]
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
* [[APPRT]]
** Category: [[annotation]]
+
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[GUANPRIBOSYLTRAN-RXN]]
== Pathway(s) associated ==
+
* [[HPRT]]
* [[PWY-7511]]
+
* [[HYPOXANPRIBOSYLTRAN-RXN]]
** '''7''' reactions found over '''9''' reactions in the full pathway
+
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
{{#set: transcription-direction=negative}}
+
* [[OROPRIBTRANS-RXN]]
{{#set: right-end-position=67856}}
+
* [[ORPRT]]
{{#set: left-end-position=57781}}
+
* [[PRPPAMIDOTRANS-RXN]]
{{#set: centisome-position=20.95861    }}
+
* [[PRPPSYN-RXN]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[PRTRANS-RXN]]
{{#set: nb reaction associated=1}}
+
* [[QUINOPRIBOTRANS-RXN]]
{{#set: nb pathway associated=1}}
+
* [[RPDPK]]
 +
* [[RXN-14270]]
 +
* [[URACIL-PRIBOSYLTRANS-RXN]]
 +
* [[XPPRT]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[APPRT]]
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[GUANPRIBOSYLTRAN-RXN]]
 +
* [[HPRT]]
 +
* [[OROPRIBTRANS-RXN]]
 +
* [[ORPRT]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[PRTRANS-RXN]]
 +
* [[R5PDP]]
 +
* [[RPDPK]]
 +
* [[XPPRT]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=5-phospho-α-d-ribose 1-diphosphate}}
 +
{{#set: inchi-key=inchikey=pqgcedqwhsbajp-txicztdvsa-i}}
 +
{{#set: molecular-weight=385.031}}

Latest revision as of 11:15, 18 March 2021

Metabolite PRPP

  • common-name:
    • 5-phospho-α-d-ribose 1-diphosphate
  • smiles:
    • c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
  • inchi-key:
    • pqgcedqwhsbajp-txicztdvsa-i
  • molecular-weight:
    • 385.031

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality