Difference between revisions of "PSEUDOURIDINE-5-P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15125 == * common-name: ** 2,4-dihydroxyhept-2-enedioate * smiles: ** c(=o)([o-])ccc(o)c=c(o)c(=o)[o-] * inchi-key: ** apnidhdqyiszae...") |
(Created page with "Category:metabolite == Metabolite PSEUDOURIDINE-5-P == * common-name: ** pseudouridine 5'-phosphate * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) * in...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PSEUDOURIDINE-5-P == |
* common-name: | * common-name: | ||
| − | ** | + | ** pseudouridine 5'-phosphate |
* smiles: | * smiles: | ||
| − | ** c(=o)([o-]) | + | ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mobmojgxnhllir-gbndhiklsa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 322.168 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15703]] |
| + | * [[RXN0-5398]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[PSEUDOURIDINE-KINASE-RXN]] |
| + | * [[RXN-15703]] | ||
| + | * [[RXN0-5398]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pseudouridine 5'-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mobmojgxnhllir-gbndhiklsa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=322.168}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite PSEUDOURIDINE-5-P
- common-name:
- pseudouridine 5'-phosphate
- smiles:
- c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))
- inchi-key:
- mobmojgxnhllir-gbndhiklsa-l
- molecular-weight:
- 322.168
