Difference between revisions of "PSEUDOURIDINE-5-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7Z-3-oxo-hexadec-7-enoyl-ACPs == * common-name: ** a (7z)-3-oxo-hexadec-7-enoyl-[acp] == Reaction(s) known to consume the compound == * [...")
(Created page with "Category:metabolite == Metabolite PSEUDOURIDINE-5-P == * common-name: ** pseudouridine 5'-phosphate * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) * in...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 7Z-3-oxo-hexadec-7-enoyl-ACPs ==
+
== Metabolite PSEUDOURIDINE-5-P ==
 
* common-name:
 
* common-name:
** a (7z)-3-oxo-hexadec-7-enoyl-[acp]
+
** pseudouridine 5'-phosphate
 +
* smiles:
 +
** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))
 +
* inchi-key:
 +
** mobmojgxnhllir-gbndhiklsa-l
 +
* molecular-weight:
 +
** 322.168
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16622]]
+
* [[RXN-15703]]
 +
* [[RXN0-5398]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16621]]
+
* [[PSEUDOURIDINE-KINASE-RXN]]
 +
* [[RXN-15703]]
 +
* [[RXN0-5398]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (7z)-3-oxo-hexadec-7-enoyl-[acp]}}
+
{{#set: common-name=pseudouridine 5'-phosphate}}
 +
{{#set: inchi-key=inchikey=mobmojgxnhllir-gbndhiklsa-l}}
 +
{{#set: molecular-weight=322.168}}

Latest revision as of 11:12, 18 March 2021

Metabolite PSEUDOURIDINE-5-P

  • common-name:
    • pseudouridine 5'-phosphate
  • smiles:
    • c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))
  • inchi-key:
    • mobmojgxnhllir-gbndhiklsa-l
  • molecular-weight:
    • 322.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality