Difference between revisions of "PSEUDOURIDINE-5-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16195 == * transcription-direction: ** negative * right-end-position: ** 139212 * left-end-position: ** 132198 * centisome-position: ** 46.189003...")
 
(Created page with "Category:metabolite == Metabolite PSEUDOURIDINE-5-P == * common-name: ** pseudouridine 5'-phosphate * smiles: ** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2)) * in...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ16195 ==
+
== Metabolite PSEUDOURIDINE-5-P ==
* transcription-direction:
+
* common-name:
** negative
+
** pseudouridine 5'-phosphate
* right-end-position:
+
* smiles:
** 139212
+
** c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))
* left-end-position:
+
* inchi-key:
** 132198
+
** mobmojgxnhllir-gbndhiklsa-l
* centisome-position:
+
* molecular-weight:
** 46.189003   
+
** 322.168
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15703]]
== Reaction(s) associated ==
+
* [[RXN0-5398]]
* [[3.1.3.16-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[PSEUDOURIDINE-KINASE-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-15703]]
** Category: [[orthology]]
+
* [[RXN0-5398]]
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
* [[4-NITROPHENYLPHOSPHATASE-RXN]]
+
{{#set: common-name=pseudouridine 5'-phosphate}}
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=mobmojgxnhllir-gbndhiklsa-l}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=322.168}}
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=139212}}
 
{{#set: left-end-position=132198}}
 
{{#set: centisome-position=46.189003    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite PSEUDOURIDINE-5-P

  • common-name:
    • pseudouridine 5'-phosphate
  • smiles:
    • c1(nc(=o)nc(=o)c=1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))
  • inchi-key:
    • mobmojgxnhllir-gbndhiklsa-l
  • molecular-weight:
    • 322.168

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality