Difference between revisions of "PUTRESCINE"

Latest revision as of 11:17, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-15362 ==
+== Metabolite PUTRESCINE ==
 * common-name:
-** (2e,11z)-icosa-2,11-dienoyl-coa
+** putrescine
 * smiles:
-** ccccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+** c([n+])ccc[n+]
 * inchi-key:
-** laeceuxzoonxdy-nwgwhigpsa-j
+** kidhwzjucrjvml-uhfffaoysa-p
 * molecular-weight:
-** 1053.99
+** 90.168
 == Reaction(s) known to consume the compound ==
+* [[ABC-25-RXN]]
+* [[APAPT]]
+* [[SPERMIDINESYN-RXN]]
+* [[TRANS-RXN-69]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-14485]]
+* [[ABC-25-RXN]]
+* [[AGMATIN-RXN]]
+* [[N-CARBAMOYLPUTRESCINE-AMIDASE-RXN]]
+* [[ORDC]]
+* [[ORNDECARBOX-RXN]]
+* [[SPERMIDINESYN-RXN]]
+* [[TRANS-RXN-69]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,11z)-icosa-2,11-dienoyl-coa}}
+{{#set: common-name=putrescine}}
-{{#set: inchi-key=inchikey=laeceuxzoonxdy-nwgwhigpsa-j}}
+{{#set: inchi-key=inchikey=kidhwzjucrjvml-uhfffaoysa-p}}
-{{#set: molecular-weight=1053.99}}
+{{#set: molecular-weight=90.168}}