Difference between revisions of "PWY-0"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ] == * common-na...")
(Created page with "Category:pathway == Pathway PWY-0 == * taxonomic-range: ** tax-40674 * common-name: ** putrescine degradation iii == Reaction(s) found == * RXN-1 * RXN-37 == React...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ 2-HEXAPRENYL-3-METHYL-6-METHOXY-14-BENZ] ==
+
== Pathway PWY-0 ==
 +
* taxonomic-range:
 +
** tax-40674
 
* common-name:
 
* common-name:
** 6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol
+
** putrescine degradation iii
* smiles:
+
== Reaction(s) found ==
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(=c1c)o)o))c)c)c)c)c
+
* [[RXN-1]]
* inchi-key:
+
* [[RXN-37]]
** atqqulxelmejix-nsuijkaqsa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-0 RXN-0]
** 562.874
+
* [NoneRXN-36 RXN-36]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-40674}}
== Reaction(s) known to produce the compound ==
+
{{#set: common-name=putrescine degradation iii}}
* [[RXN3O-54]]
+
{{#set: nb reaction found=2}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.5}}
{{#set: common-name=6-methoxy-3-methyl-2-all-trans-hexaprenyl-1,4-benzoquinol}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=atqqulxelmejix-nsuijkaqsa-n}}
 
{{#set: molecular-weight=562.874}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-0

  • taxonomic-range:
    • tax-40674
  • common-name:
    • putrescine degradation iii

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-0 RXN-0]
  • [NoneRXN-36 RXN-36]