Difference between revisions of "PWY-1001"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-323 CPD-323] == * common-name: ** cholest-4-en-3-one * smiles: ** cc(c)cccc(c)[ch]3(cc[ch]4...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] == * common-name: ** (3e)-undec-3-enoyl-coa * smiles: ** cccccccc=ccc(=o)s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-323 CPD-323] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] ==
 
* common-name:
 
* common-name:
** cholest-4-en-3-one
+
** (3e)-undec-3-enoyl-coa
 
* smiles:
 
* smiles:
** cc(c)cccc(c)[ch]3(cc[ch]4([ch]2(ccc1(=cc(=o)ccc(c)1[ch]2ccc(c)34))))
+
** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** nyoxryyxrwjdkp-gykmgiidsa-n
+
** hvxccjiyxizgop-nadloitosa-j
 
* molecular-weight:
 
* molecular-weight:
** 384.644
+
** 929.765
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CHOLESTENONE-5-ALPHA-REDUCTASE-RXN]]
 
* [[RXN-12848]]
 
* [[RXN-17644]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-14776]]
 +
* [[RXN-14790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cholest-4-en-3-one}}
+
{{#set: common-name=(3e)-undec-3-enoyl-coa}}
{{#set: inchi-key=inchikey=nyoxryyxrwjdkp-gykmgiidsa-n}}
+
{{#set: inchi-key=inchikey=hvxccjiyxizgop-nadloitosa-j}}
{{#set: molecular-weight=384.644}}
+
{{#set: molecular-weight=929.765}}

Revision as of 14:18, 26 August 2019

Metabolite CPD-15655

  • common-name:
    • (3e)-undec-3-enoyl-coa
  • smiles:
    • cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hvxccjiyxizgop-nadloitosa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality