Difference between revisions of "PWY-101"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] == * common-name: ** (2e,7z)-tetradecenoyl-coa * smiles: ** ccccccc=ccccc=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15056 CPD-15056] == * common-name: ** (2z)-2-aminobut-2-enoate * smiles: ** cc=c(n)c(=o)[o-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19161 CPD-19161] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15056 CPD-15056] ==
 
* common-name:
 
* common-name:
** (2e,7z)-tetradecenoyl-coa
+
** (2z)-2-aminobut-2-enoate
 
* smiles:
 
* smiles:
** ccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc=c(n)c(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** mwksuvqqmpjtpp-dtpvmwfysa-j
+
** pawsvpvnixfkos-ihwypqmzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 969.83
+
** 100.097
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17793]]
+
* [[RXN-15122]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17792]]
+
* [[RXN-14048]]
 +
* [[RXN-14049]]
 +
* [[RXN-15122]]
 +
* [[RXN-15148]]
 +
* [[RXN-15149]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e,7z)-tetradecenoyl-coa}}
+
{{#set: common-name=(2z)-2-aminobut-2-enoate}}
{{#set: inchi-key=inchikey=mwksuvqqmpjtpp-dtpvmwfysa-j}}
+
{{#set: inchi-key=inchikey=pawsvpvnixfkos-ihwypqmzsa-m}}
{{#set: molecular-weight=969.83}}
+
{{#set: molecular-weight=100.097}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-15056

  • common-name:
    • (2z)-2-aminobut-2-enoate
  • smiles:
    • cc=c(n)c(=o)[o-]
  • inchi-key:
    • pawsvpvnixfkos-ihwypqmzsa-m
  • molecular-weight:
    • 100.097

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality