Difference between revisions of "PWY-1121"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] == * common-name: ** 3-oxo adrenoyl-coa * smiles: ** cccccc=ccc=ccc=ccc=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] == * common-name: ** 6-deoxocathasterone * smiles: ** cc(c)c(c)cc(o)c(c)[ch]3(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17324 CPD-17324] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-712 CPD-712] ==
 
* common-name:
 
* common-name:
** 3-oxo adrenoyl-coa
+
** 6-deoxocathasterone
 
* smiles:
 
* smiles:
** cccccc=ccc=ccc=ccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** vmajwsswcpbijy-kpovblhlsa-j
+
** zhzkwzjlunxosn-yuzbouazsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1091.996
+
** 418.702
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16112]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-773]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo adrenoyl-coa}}
+
{{#set: common-name=6-deoxocathasterone}}
{{#set: inchi-key=inchikey=vmajwsswcpbijy-kpovblhlsa-j}}
+
{{#set: inchi-key=inchikey=zhzkwzjlunxosn-yuzbouazsa-n}}
{{#set: molecular-weight=1091.996}}
+
{{#set: molecular-weight=418.702}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-712

  • common-name:
    • 6-deoxocathasterone
  • smiles:
    • cc(c)c(c)cc(o)c(c)[ch]3(cc[ch]4([ch]2(cc[ch]1(cc(o)ccc(c)1[ch]2ccc(c)34))))
  • inchi-key:
    • zhzkwzjlunxosn-yuzbouazsa-n
  • molecular-weight:
    • 418.702

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality