Difference between revisions of "PWY-1281"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORIBOSYL-FORMIMINO-AICAR-P PHOSPHORIBOSYL-FORMIMINO-AICAR-P] ==
+== Pathway PWY-1281 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** 1-(5-phospho-&beta;-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide
+** sulfoacetaldehyde degradation i
-* smiles:
+== Reaction(s) found ==
-** c(nc1(oc(cop([o-])(=o)[o-])c(o)c(o)1))=nc3(=c(c(n)=o)n=cn(c2(oc(cop([o-])(=o)[o-])c(o)c(o)2))3)
+* [[PHOSACETYLTRANS-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** qoushgmtbiiahr-keohhstqsa-j
+* [NoneRXN-2364 RXN-2364]
-* molecular-weight:
+{{#set: taxonomic-range=tax-2}}
-** 573.303
+{{#set: common-name=sulfoacetaldehyde degradation i}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[PRIBFAICARPISOM-RXN]]
+{{#set: completion rate=0.5}}
-* [[PRICI]]
+{{#set: nb total reaction=2}}
-== Reaction(s) known to produce the compound ==
-* [[HISTCYCLOHYD-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=1-(5-phospho-&beta;-d-ribosyl)-5-[(5-phosphoribosylamino)methylideneamino]imidazole-4-carboxamide}}
-{{#set: inchi-key=inchikey=qoushgmtbiiahr-keohhstqsa-j}}
-{{#set: molecular-weight=573.303}}