Difference between revisions of "PWY-1361"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] == * common-name: ** dopamine 3-o-sulfate * smiles: ** c1(=c(cc[n+])c=c(os(=...")
(Created page with "Category:pathway == Pathway PWY-1361 == * taxonomic-range: ** tax-2 * common-name: ** benzoyl-coa degradation i (aerobic) == Reaction(s) found == * RXN-2425 * RXN0-2...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7649 CPD-7649] ==
+
== Pathway PWY-1361 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** dopamine 3-o-sulfate
+
** benzoyl-coa degradation i (aerobic)
* smiles:
+
== Reaction(s) found ==
** c1(=c(cc[n+])c=c(os(=o)(=o)[o-])c(o)=c1)
+
* [[RXN-2425]]
* inchi-key:
+
* [[RXN0-2044]]
** nzkryjgnypyxjz-uhfffaoysa-n
+
== Reaction(s) not found ==
* molecular-weight:
+
* [NoneRXN-3641 RXN-3641]
** 233.239
+
* [NoneRXN-11053 RXN-11053]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-2424 RXN-2424]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-2401 RXN-2401]
* [[RXN6666-9]]
+
* [NoneRXN-11054 RXN-11054]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-2}}
{{#set: common-name=dopamine 3-o-sulfate}}
+
{{#set: common-name=benzoyl-coa degradation i (aerobic)}}
{{#set: inchi-key=inchikey=nzkryjgnypyxjz-uhfffaoysa-n}}
+
{{#set: nb reaction found=2}}
{{#set: molecular-weight=233.239}}
+
{{#set: completion rate=0.29}}
 +
{{#set: nb total reaction=7}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-1361

  • taxonomic-range:
    • tax-2
  • common-name:
    • benzoyl-coa degradation i (aerobic)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-3641 RXN-3641]
  • [NoneRXN-11053 RXN-11053]
  • [NoneRXN-2424 RXN-2424]
  • [NoneRXN-2401 RXN-2401]
  • [NoneRXN-11054 RXN-11054]