Difference between revisions of "PWY-1422"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12122 CPD-12122] == * common-name: ** demethylmenaquinol-13 * smiles: ** cc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-L-GLUTAMYL-L-AMINO-ACID 5-L-GLUTAMYL-L-AMINO-ACID] == * common-name: ** an α-(γ-l...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12122 CPD-12122] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-L-GLUTAMYL-L-AMINO-ACID 5-L-GLUTAMYL-L-AMINO-ACID] ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-13
+
** an α-(γ-l-glutamyl)-l-amino acid
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c)c
 
* inchi-key:
 
** hpjvtyodwhyfmv-znwikrofsa-n
 
* molecular-weight:
 
** 1045.709
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9366]]
+
* [[GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-6601]]
 +
* [[RXN66-336]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-13}}
+
{{#set: common-name=an α-(γ-l-glutamyl)-l-amino acid}}
{{#set: inchi-key=inchikey=hpjvtyodwhyfmv-znwikrofsa-n}}
 
{{#set: molecular-weight=1045.709}}
 

Revision as of 09:22, 27 August 2019

Metabolite 5-L-GLUTAMYL-L-AMINO-ACID

  • common-name:
    • an α-(γ-l-glutamyl)-l-amino acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality