Difference between revisions of "PWY-1501"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-N-o-methyl-arginines Histone-N-o-methyl-arginines] == * common-name: ** [histone]-n&ome...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12581 CPD-12581] == * common-name: ** s-(2e,6e)-farnesyl-l-cysteine * smiles: ** cc(c)=cccc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12581 CPD-12581] == |
* common-name: | * common-name: | ||
| − | ** [ | + | ** s-(2e,6e)-farnesyl-l-cysteine |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-] | ||
| + | * inchi-key: | ||
| + | ** syslnqmklrogcl-bcyuyympsa-n | ||
| + | * molecular-weight: | ||
| + | ** 325.508 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-11623]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-(2e,6e)-farnesyl-l-cysteine}} |
| + | {{#set: inchi-key=inchikey=syslnqmklrogcl-bcyuyympsa-n}} | ||
| + | {{#set: molecular-weight=325.508}} | ||
Revision as of 14:18, 26 August 2019
Contents
Metabolite CPD-12581
- common-name:
- s-(2e,6e)-farnesyl-l-cysteine
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccscc([n+])c(=o)[o-]
- inchi-key:
- syslnqmklrogcl-bcyuyympsa-n
- molecular-weight:
- 325.508
