Difference between revisions of "PWY-1622"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17063 CPD-17063] == * common-name: ** ferroheme o * smiles: ** c=cc4(=c(c)c8(=[n+]5([fe--]2...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NARINGENIN-CMPD NARINGENIN-CMPD] == * common-name: ** (2s)-naringenin * smiles: ** c3(=c(c2(oc1...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17063 CPD-17063] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NARINGENIN-CMPD NARINGENIN-CMPD] ==
 
* common-name:
 
* common-name:
** ferroheme o
+
** (2s)-naringenin
 
* smiles:
 
* smiles:
** c=cc4(=c(c)c8(=[n+]5([fe--]26([n+]1(=c(c(c)=c(ccc(=o)[o-])c1=cc3(n2c(=c(c)c(ccc(=o)[o-])=3)c=c45))c=c7(c(c)=c(c(o)ccc=c(ccc=c(c)ccc=c(c)c)c)c(n67)=c8))))))
+
** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
 
* inchi-key:
 
* inchi-key:
** fispassvcdrerw-arqjtvbpsa-j
+
** ftvwirxfelqlpi-zdusscgksa-n
 
* molecular-weight:
 
* molecular-weight:
** 836.852
+
** 272.257
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HEMEOSYN-RXN]]
+
* [[APIGNAR-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=ferroheme o}}
+
{{#set: common-name=(2s)-naringenin}}
{{#set: inchi-key=inchikey=fispassvcdrerw-arqjtvbpsa-j}}
+
{{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}}
{{#set: molecular-weight=836.852}}
+
{{#set: molecular-weight=272.257}}

Revision as of 14:18, 26 August 2019

Metabolite NARINGENIN-CMPD

  • common-name:
    • (2s)-naringenin
  • smiles:
    • c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
  • inchi-key:
    • ftvwirxfelqlpi-zdusscgksa-n
  • molecular-weight:
    • 272.257

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality