Difference between revisions of "PWY-1781"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-207 CPD-207] ==
+== Pathway PWY-1781 ==
+* taxonomic-range:
+** tax-1224
 * common-name:
-** phenylacetyl-coa
+** &beta;-alanine degradation ii
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[RXN-2902]]
-* inchi-key:
+== Reaction(s) not found ==
-** zigifdrjfzyeeq-cecatxlmsa-j
+* [None2.6.1.18-RXN 2.6.1.18-RXN]
-* molecular-weight:
+{{#set: taxonomic-range=tax-1224}}
-** 881.637
+{{#set: common-name=&beta;-alanine degradation ii}}
-== Reaction(s) known to consume the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-10821]]
+{{#set: completion rate=0.5}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=2}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=phenylacetyl-coa}}
-{{#set: inchi-key=inchikey=zigifdrjfzyeeq-cecatxlmsa-j}}
-{{#set: molecular-weight=881.637}}