Difference between revisions of "PWY-1781"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * common-name: ** 4-hydroxybenzoate * smiles: ** c(c1(c...")
 
(Created page with "Category:pathway == Pathway PWY-1781 == * taxonomic-range: ** tax-1224 * common-name: ** β-alanine degradation ii == Reaction(s) found == * RXN-2902 == Reaction(s...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] ==
+
== Pathway PWY-1781 ==
 +
* taxonomic-range:
 +
** tax-1224
 
* common-name:
 
* common-name:
** 4-hydroxybenzoate
+
** β-alanine degradation ii
* smiles:
+
== Reaction(s) found ==
** c(c1(c=cc(=cc=1)o))(=o)[o-]
+
* [[RXN-2902]]
* inchi-key:
+
== Reaction(s) not found ==
** fjkrolugyxjwqn-uhfffaoysa-m
+
* [None2.6.1.18-RXN 2.6.1.18-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-1224}}
** 137.115
+
{{#set: common-name=β-alanine degradation ii}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
+
{{#set: completion rate=0.5}}
* [[RXN-9003]]
+
{{#set: nb total reaction=2}}
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=4-hydroxybenzoate}}
 
{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
 
{{#set: molecular-weight=137.115}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-1781

  • taxonomic-range:
    • tax-1224
  • common-name:
    • β-alanine degradation ii

Reaction(s) found

Reaction(s) not found

  • [None2.6.1.18-RXN 2.6.1.18-RXN]