Difference between revisions of "PWY-1781"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] == * common-name: ** 4-hydroxybenzoate * smiles: ** c(c1(c...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9768 CPD-9768] == * common-name: ** (2e)-hexadecenoate * smiles: ** cccccccccccccc=cc(=o)[o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-hydroxybenzoate 4-hydroxybenzoate] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9768 CPD-9768] ==
 
* common-name:
 
* common-name:
** 4-hydroxybenzoate
+
** (2e)-hexadecenoate
 
* smiles:
 
* smiles:
** c(c1(c=cc(=cc=1)o))(=o)[o-]
+
** cccccccccccccc=cc(=o)[o-]
 
* inchi-key:
 
* inchi-key:
** fjkrolugyxjwqn-uhfffaoysa-m
+
** zvrmgcsssyzgsm-ccezhusrsa-m
 
* molecular-weight:
 
* molecular-weight:
** 137.115
+
** 253.404
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 
* [[RXN-9003]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16656]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxybenzoate}}
+
{{#set: common-name=(2e)-hexadecenoate}}
{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=zvrmgcsssyzgsm-ccezhusrsa-m}}
{{#set: molecular-weight=137.115}}
+
{{#set: molecular-weight=253.404}}

Revision as of 14:19, 26 August 2019

Metabolite CPD-9768

  • common-name:
    • (2e)-hexadecenoate
  • smiles:
    • cccccccccccccc=cc(=o)[o-]
  • inchi-key:
    • zvrmgcsssyzgsm-ccezhusrsa-m
  • molecular-weight:
    • 253.404

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality