Difference between revisions of "PWY-181"

Revision as of 14:18, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1091 CPD-1091] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE-5-PHOSPHATE XANTHOSINE-5-PHOSPHATE] ==
 * common-name:
-** (s)-ureidoglycolate
+** xmp
 * smiles:
-** c(o)(c([o-])=o)nc(n)=o
+** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)n3(c=nc2(c(=o)nc(=o)nc=23)))
 * inchi-key:
-** nwzyycviokvtii-sfowxeaesa-m
+** dctlyfzhfgencw-uuokfmhzsa-l
 * molecular-weight:
-** 133.083
+** 362.192
 == Reaction(s) known to consume the compound ==
+* [[GMP-SYN-GLUT-RXN]]
+* [[GMP-SYN-NH3-RXN]]
+* [[IMP-DEHYDROG-RXN]]
+* [[X5NT]]
+* [[XMPXAN-RXN]]
+* [[XPPRT]]
 == Reaction(s) known to produce the compound ==
-* [[ALLANTOICASE-RXN]]
+* [[IMP-DEHYDROG-RXN]]
+* [[NTPD]]
+* [[RXN0-1603]]
+* [[XPPRT]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(s)-ureidoglycolate}}
+{{#set: common-name=xmp}}
-{{#set: inchi-key=inchikey=nwzyycviokvtii-sfowxeaesa-m}}
+{{#set: inchi-key=inchikey=dctlyfzhfgencw-uuokfmhzsa-l}}
-{{#set: molecular-weight=133.083}}
+{{#set: molecular-weight=362.192}}