Difference between revisions of "PWY-1861"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == * common-name: ** densipoloyl-coa * smiles: ** ccc=cccc(o)cc=ccccccccc(...")
(Created page with "Category:pathway == Pathway PWY-1861 == * taxonomic-range: ** tax-2 * common-name: ** formaldehyde assimilation ii (assimilatory rump cycle) == Reaction(s) found == * 1T...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] ==
+
== Pathway PWY-1861 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** densipoloyl-coa
+
** formaldehyde assimilation ii (assimilatory rump cycle)
* smiles:
+
== Reaction(s) found ==
** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
* [[1TRANSKETO-RXN]]
* inchi-key:
+
* [[2TRANSKETO-RXN]]
** qebzgoipmjeisg-apevuuacsa-j
+
* [[6PFRUCTPHOS-RXN]]
* molecular-weight:
+
* [[F16ALDOLASE-RXN]]
** 1041.936
+
* [[RIB5PISOM-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[RIBULP3EPIM-RXN]]
* [[RXN-16150]]
+
* [[TRANSALDOL-RXN]]
* [[RXN-16153]]
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* [NoneR12-RXN R12-RXN]
* [[RXN-16150]]
+
* [NoneR10-RXN R10-RXN]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-2}}
{{#set: common-name=densipoloyl-coa}}
+
{{#set: common-name=formaldehyde assimilation ii (assimilatory rump cycle)}}
{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
+
{{#set: nb reaction found=7}}
{{#set: molecular-weight=1041.936}}
+
{{#set: completion rate=0.78}}
 +
{{#set: nb total reaction=9}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-1861

  • taxonomic-range:
    • tax-2
  • common-name:
    • formaldehyde assimilation ii (assimilatory rump cycle)

Reaction(s) found

Reaction(s) not found

  • [NoneR12-RXN R12-RXN]
  • [NoneR10-RXN R10-RXN]