Difference between revisions of "PWY-1861"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] ==
+== Pathway PWY3O-4108 ==
+* taxonomic-range:
+** tax-4751
 * common-name:
-** densipoloyl-coa
+** l-tyrosine degradation iii
-* smiles:
+== Reaction(s) found ==
-** ccc=cccc(o)cc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN3O-4113]]
-* inchi-key:
+* [[TYROSINE-AMINOTRANSFERASE-RXN]]
-** qebzgoipmjeisg-apevuuacsa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [None4.1.1.80-RXN 4.1.1.80-RXN]
-** 1041.936
+* [NoneRXN3O-4157 RXN3O-4157]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-4751}}
-* [[RXN-16150]]
+{{#set: common-name=l-tyrosine degradation iii}}
-* [[RXN-16153]]
+{{#set: nb reaction found=2}}
-== Reaction(s) known to produce the compound ==
+{{#set: completion rate=0.5}}
-* [[RXN-16150]]
+{{#set: nb total reaction=4}}
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=densipoloyl-coa}}
-{{#set: inchi-key=inchikey=qebzgoipmjeisg-apevuuacsa-j}}
-{{#set: molecular-weight=1041.936}}