Difference between revisions of "PWY-1881"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9904 CPD-9904] == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate * s...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SS-Oligoribonucleotides SS-Oligoribonucleotides] == * common-name: ** a single-stranded oligori...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9904 CPD-9904] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SS-Oligoribonucleotides SS-Oligoribonucleotides] ==
 
* common-name:
 
* common-name:
** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
+
** a single-stranded oligoribonucleotide
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
 
* inchi-key:
 
** kybjqeicwvewil-tuumqracsa-m
 
* molecular-weight:
 
** 643.968
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9287]]
+
* [[3.1.26.11-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}}
+
{{#set: common-name=a single-stranded oligoribonucleotide}}
{{#set: inchi-key=inchikey=kybjqeicwvewil-tuumqracsa-m}}
 
{{#set: molecular-weight=643.968}}
 

Revision as of 14:19, 26 August 2019

Metabolite SS-Oligoribonucleotides

  • common-name:
    • a single-stranded oligoribonucleotide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality