Difference between revisions of "PWY-2002"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-L-GLUTAMYL-PEPTIDE 5-L-GLUTAMYL-PEPTIDE] == * common-name: ** a 5-l-glutamyl-[peptide] == Rea...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] == * common-name: ** (2s)-dihydrotricetin * smiles: ** c3(c(c2(oc1(c=c(c=c(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-L-GLUTAMYL-PEPTIDE 5-L-GLUTAMYL-PEPTIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] ==
 
* common-name:
 
* common-name:
** a 5-l-glutamyl-[peptide]
+
** (2s)-dihydrotricetin
 +
* smiles:
 +
** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
 +
* inchi-key:
 +
** usqxpewrywrrjd-lbprgkrzsa-m
 +
* molecular-weight:
 +
** 303.248
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GAMMA-GLUTAMYLTRANSFERASE-RXN]]
+
* [[RXN-7922]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 5-l-glutamyl-[peptide]}}
+
{{#set: common-name=(2s)-dihydrotricetin}}
 +
{{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}}
 +
{{#set: molecular-weight=303.248}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-7214

  • common-name:
    • (2s)-dihydrotricetin
  • smiles:
    • c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
  • inchi-key:
    • usqxpewrywrrjd-lbprgkrzsa-m
  • molecular-weight:
    • 303.248

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality