Difference between revisions of "PWY-2002"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7214 CPD-7214] ==
+== Pathway PWY-5525 ==
+* taxonomic-range:
+** tax-7742
 * common-name:
-** (2s)-dihydrotricetin
+** d-glucuronate degradation i
-* smiles:
+== Reaction(s) found ==
-** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
+* [[GLUCURONATE-REDUCTASE-RXN]]
-* inchi-key:
+* [[L-XYLULOSE-REDUCTASE-RXN]]
-** usqxpewrywrrjd-lbprgkrzsa-m
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-14693 RXN-14693]
-** 303.248
+* [NoneL-GULONATE-3-DEHYDROGENASE-RXN L-GULONATE-3-DEHYDROGENASE-RXN]
-== Reaction(s) known to consume the compound ==
+* [NoneDEHYDRO-L-GULONATE-DECARBOXYLASE-RXN DEHYDRO-L-GULONATE-DECARBOXYLASE-RXN]
-* [[RXN-7922]]
+{{#set: taxonomic-range=tax-7742}}
-== Reaction(s) known to produce the compound ==
+{{#set: common-name=d-glucuronate degradation i}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=2}}
-{{#set: common-name=(2s)-dihydrotricetin}}
+{{#set: completion rate=0.4}}
-{{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}}
+{{#set: nb total reaction=5}}
-{{#set: molecular-weight=303.248}}