Difference between revisions of "PWY-2181"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * common-name: ** taxiphyllin * smiles: ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o...")
(Created page with "Category:pathway == Pathway PWY-2181 == * taxonomic-range: ** tax-58024 * common-name: ** free phenylpropanoid acid biosynthesis == Reaction(s) found == * RXN-1104 * [...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] ==
+
== Pathway PWY-2181 ==
 +
* taxonomic-range:
 +
** tax-58024
 
* common-name:
 
* common-name:
** taxiphyllin
+
** free phenylpropanoid acid biosynthesis
* smiles:
+
== Reaction(s) found ==
** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n)
+
* [[RXN-1104]]
* inchi-key:
+
* [[RXN-1121]]
** nvltyojhpbmilu-gmdxdwkasa-n
+
* [[RXN-3422]]
* molecular-weight:
+
== Reaction(s) not found ==
** 311.291
+
* [NoneRXN-1103 RXN-1103]
== Reaction(s) known to consume the compound ==
+
{{#set: taxonomic-range=tax-58024}}
* [[RXN-13600]]
+
{{#set: common-name=free phenylpropanoid acid biosynthesis}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=3}}
== Reaction(s) of unknown directionality ==
+
{{#set: completion rate=0.75}}
{{#set: common-name=taxiphyllin}}
+
{{#set: nb total reaction=4}}
{{#set: inchi-key=inchikey=nvltyojhpbmilu-gmdxdwkasa-n}}
 
{{#set: molecular-weight=311.291}}
 

Latest revision as of 11:00, 18 March 2021

Pathway PWY-2181

  • taxonomic-range:
    • tax-58024
  • common-name:
    • free phenylpropanoid acid biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-1103 RXN-1103]