Difference between revisions of "PWY-2181"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALONYL-ACP MALONYL-ACP] == * common-name: ** a malonyl-[acp] == Reaction(s) known to consume t...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == * common-name: ** taxiphyllin * smiles: ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1103 CPD-1103] == |
* common-name: | * common-name: | ||
| − | ** | + | ** taxiphyllin |
| + | * smiles: | ||
| + | ** c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n) | ||
| + | * inchi-key: | ||
| + | ** nvltyojhpbmilu-gmdxdwkasa-n | ||
| + | * molecular-weight: | ||
| + | ** 311.291 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-13600]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=taxiphyllin}} |
| + | {{#set: inchi-key=inchikey=nvltyojhpbmilu-gmdxdwkasa-n}} | ||
| + | {{#set: molecular-weight=311.291}} | ||
Revision as of 14:19, 26 August 2019
Contents
Metabolite CPD-1103
- common-name:
- taxiphyllin
- smiles:
- c1(c=c(o)c=cc=1c(oc2(oc(co)c(o)c(o)c(o)2))c#n)
- inchi-key:
- nvltyojhpbmilu-gmdxdwkasa-n
- molecular-weight:
- 311.291
