Difference between revisions of "PWY-2181"

Revision as of 20:18, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=R-2-HYDROXYGLUTARATE R-2-HYDROXYGLUTARATE] ==
+== Pathway PWY-6657 ==
+* taxonomic-range:
+** tax-2157
+** tax-2
 * common-name:
-** (r)-2-hydroxyglutarate
+** polyhydroxydecanoate biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c(ccc(c([o-])=o)o)([o-])=o
+* [[RXN-11797]]
-* inchi-key:
+* [[RXN-7699]]
-** hwxbtnavrsuojr-gsvougtgsa-l
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-11796 RXN-11796]
-** 146.099
+{{#set: taxonomic-range=tax-2|tax-2157}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=polyhydroxydecanoate biosynthesis}}
-* [[KETOGLUTREDUCT-RXN]]
+{{#set: nb reaction found=2}}
-* [[RXN-14932]]
+{{#set: completion rate=0.67}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb total reaction=3}}
-* [[KETOGLUTREDUCT-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=(r)-2-hydroxyglutarate}}
-{{#set: inchi-key=inchikey=hwxbtnavrsuojr-gsvougtgsa-l}}
-{{#set: molecular-weight=146.099}}