Difference between revisions of "PWY-2221"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] == * common-name: ** isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(...")
(Created page with "Category:pathway == Pathway PWY-2221 == * taxonomic-range: ** tax-183963 ** tax-183924 * common-name: ** entner-doudoroff pathway iii (semi-phosphorylative) == Reaction(s)...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] ==
+
== Pathway PWY-2221 ==
 +
* taxonomic-range:
 +
** tax-183963
 +
** tax-183924
 
* common-name:
 
* common-name:
−
** isobutanoyl-coa
+
** entner-doudoroff pathway iii (semi-phosphorylative)
−
* smiles:
+
== Reaction(s) found ==
−
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
* [[2PGADEHYDRAT-RXN]]
−
* inchi-key:
+
* [[3PGAREARR-RXN]]
−
** aewhywspvrzhct-ndzskpawsa-j
+
* [[GLUCONOLACT-RXN]]
−
* molecular-weight:
+
* [[KDPGALDOL-RXN]]
−
** 833.593
+
* [[PEPDEPHOS-RXN]]
−
== Reaction(s) known to consume the compound ==
+
* [[RXN-3443]]
−
* [[2.3.1.168-RXN]]
+
== Reaction(s) not found ==
−
* [[MCDH]]
+
* [NoneGLUCOSE-1-DEHYDROGENASE-NADP+-RXN GLUCOSE-1-DEHYDROGENASE-NADP+-RXN]
−
== Reaction(s) known to produce the compound ==
+
* [NoneDEOXYGLUCONOKIN-RXN DEOXYGLUCONOKIN-RXN]
−
* [[1.2.1.25-RXN]]
+
* [NoneGLUCONATE-DEHYDRATASE-RXN GLUCONATE-DEHYDRATASE-RXN]
−
* [[2.3.1.168-RXN]]
+
{{#set: taxonomic-range=tax-183924|tax-183963}}
−
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
+
{{#set: common-name=entner-doudoroff pathway iii (semi-phosphorylative)}}
−
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=6}}
−
{{#set: common-name=isobutanoyl-coa}}
+
{{#set: completion rate=0.67}}
−
{{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}}
+
{{#set: nb total reaction=9}}
−
{{#set: molecular-weight=833.593}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-2221

  • taxonomic-range:
    • tax-183963
    • tax-183924
  • common-name:
    • entner-doudoroff pathway iii (semi-phosphorylative)

Reaction(s) found

Reaction(s) not found

  • [NoneGLUCOSE-1-DEHYDROGENASE-NADP+-RXN GLUCOSE-1-DEHYDROGENASE-NADP+-RXN]
  • [NoneDEOXYGLUCONOKIN-RXN DEOXYGLUCONOKIN-RXN]
  • [NoneGLUCONATE-DEHYDRATASE-RXN GLUCONATE-DEHYDRATASE-RXN]



Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=PWY-2221&oldid=130558"