Difference between revisions of "PWY-2221"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHO-RIBOSYL-GLYCINEAMIDE 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE] == * common-name: ** n1-(5-phosp...")
 
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] == * common-name: ** isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHO-RIBOSYL-GLYCINEAMIDE 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] ==
 
* common-name:
 
* common-name:
** n1-(5-phospho-β-d-ribosyl)glycinamide
+
** isobutanoyl-coa
 
* smiles:
 
* smiles:
** c([n+])c(=o)nc1(c(o)c(o)c(cop([o-])(=o)[o-])o1)
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
 
* inchi-key:
 
* inchi-key:
** obqmlsfouzuiob-shuuezrqsa-m
+
** aewhywspvrzhct-ndzskpawsa-j
 
* molecular-weight:
 
* molecular-weight:
** 285.17
+
** 833.593
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[FPGFTh]]
+
* [[2.3.1.168-RXN]]
* [[GART-RXN]]
+
* [[MCDH]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FGFTh]]
+
* [[1.2.1.25-RXN]]
* [[FPGFTh]]
+
* [[2.3.1.168-RXN]]
* [[GART-RXN]]
+
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
* [[GLYRIBONUCSYN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n1-(5-phospho-β-d-ribosyl)glycinamide}}
+
{{#set: common-name=isobutanoyl-coa}}
{{#set: inchi-key=inchikey=obqmlsfouzuiob-shuuezrqsa-m}}
+
{{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}}
{{#set: molecular-weight=285.17}}
+
{{#set: molecular-weight=833.593}}

Revision as of 14:18, 26 August 2019

Metabolite ISOBUTYRYL-COA

  • common-name:
    • isobutanoyl-coa
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
  • inchi-key:
    • aewhywspvrzhct-ndzskpawsa-j
  • molecular-weight:
    • 833.593

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality