Difference between revisions of "PWY-2221"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHO-RIBOSYL-GLYCINEAMIDE 5-PHOSPHO-RIBOSYL-GLYCINEAMIDE] == * common-name: ** n1-(5-phosp...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] == * common-name: ** isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] == |
* common-name: | * common-name: | ||
− | ** | + | ** isobutanoyl-coa |
* smiles: | * smiles: | ||
− | ** c( | + | ** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** aewhywspvrzhct-ndzskpawsa-j |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 833.593 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2.3.1.168-RXN]] |
− | * [[ | + | * [[MCDH]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[1.2.1.25-RXN]] |
− | + | * [[2.3.1.168-RXN]] | |
− | * [[ | + | * [[DHRT_LPAREN_ibcoa_RPAREN_]] |
− | * [[ | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=isobutanoyl-coa}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=833.593}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite ISOBUTYRYL-COA
- common-name:
- isobutanoyl-coa
- smiles:
- cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
- inchi-key:
- aewhywspvrzhct-ndzskpawsa-j
- molecular-weight:
- 833.593