Difference between revisions of "PWY-2221"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] == * common-name: ** isobutanoyl-coa * smiles: ** cc(c(=o)sccnc(...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FECOSTEROL FECOSTEROL] == * common-name: ** fecosterol * smiles: ** cc(c)c(=c)ccc(c)[ch]3(cc[ch...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ISOBUTYRYL-COA ISOBUTYRYL-COA] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FECOSTEROL FECOSTEROL] ==
 
* common-name:
 
* common-name:
** isobutanoyl-coa
+
** fecosterol
 
* smiles:
 
* smiles:
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34))))
 
* inchi-key:
 
* inchi-key:
** aewhywspvrzhct-ndzskpawsa-j
+
** slqkysphbzmasj-qkporzecsa-n
 
* molecular-weight:
 
* molecular-weight:
** 833.593
+
** 398.671
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.3.1.168-RXN]]
+
* [[RXN3O-203]]
* [[MCDH]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.2.1.25-RXN]]
+
* [[RXN3O-178]]
* [[2.3.1.168-RXN]]
 
* [[DHRT_LPAREN_ibcoa_RPAREN_]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isobutanoyl-coa}}
+
{{#set: common-name=fecosterol}}
{{#set: inchi-key=inchikey=aewhywspvrzhct-ndzskpawsa-j}}
+
{{#set: inchi-key=inchikey=slqkysphbzmasj-qkporzecsa-n}}
{{#set: molecular-weight=833.593}}
+
{{#set: molecular-weight=398.671}}

Revision as of 09:22, 27 August 2019

Metabolite FECOSTEROL

  • common-name:
    • fecosterol
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(cc(o)ccc(c)1c=2ccc(c)34))))
  • inchi-key:
    • slqkysphbzmasj-qkporzecsa-n
  • molecular-weight:
    • 398.671

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality