Difference between revisions of "PWY-2301"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi...") |
(Created page with "Category:pathway == Pathway PWY-2301 == * taxonomic-range: ** tax-2759 ** tax-2 ** tax-2157 * common-name: ** myo-inositol biosynthesis == Reaction(s) found == * MYO-INO...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-2301 == |
+ | * taxonomic-range: | ||
+ | ** tax-2759 | ||
+ | ** tax-2 | ||
+ | ** tax-2157 | ||
* common-name: | * common-name: | ||
− | ** | + | ** myo-inositol biosynthesis |
− | + | == Reaction(s) found == | |
− | + | * [[MYO-INOSITOL-1-PHOSPHATE-SYNTHASE-RXN]] | |
− | + | * [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]] | |
− | + | == Reaction(s) not found == | |
− | + | All reactions of this pathways are in present | |
− | + | {{#set: taxonomic-range=tax-2|tax-2157|tax-2759}} | |
− | == Reaction(s) | + | {{#set: common-name=myo-inositol biosynthesis}} |
− | * [[ | + | {{#set: nb reaction found=2}} |
− | + | {{#set: completion rate=1.0}} | |
− | * [[ | + | {{#set: nb total reaction=2}} |
− | == Reaction(s) of | ||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 10:59, 18 March 2021
Pathway PWY-2301
- taxonomic-range:
- tax-2759
- tax-2
- tax-2157
- common-name:
- myo-inositol biosynthesis
Reaction(s) found
Reaction(s) not found
All reactions of this pathways are in present