Difference between revisions of "PWY-2301"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == |
* common-name: | * common-name: | ||
− | ** | + | ** salicylate |
* smiles: | * smiles: | ||
− | ** | + | ** c(c1(=cc=cc=c1o))([o-])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ygsdefsmjlzeoe-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 137.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[SALICYLATE-1-MONOOXYGENASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXNQT-4366]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=salicylate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ygsdefsmjlzeoe-uhfffaoysa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=137.115}} |
Revision as of 09:22, 27 August 2019
Contents
Metabolite CPD-110
- common-name:
- salicylate
- smiles:
- c(c1(=cc=cc=c1o))([o-])=o
- inchi-key:
- ygsdefsmjlzeoe-uhfffaoysa-m
- molecular-weight:
- 137.115