Difference between revisions of "PWY-2301"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] == * common-name: ** (2e)-5-methylhexa-2,4-dienoyl-coa * smiles: ** cc(c)=...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] == * common-name: ** salicylate * smiles: ** c(c1(=cc=cc=c1o))([o-])=o * inchi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12904 CPD-12904] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-110 CPD-110] ==
 
* common-name:
 
* common-name:
** (2e)-5-methylhexa-2,4-dienoyl-coa
+
** salicylate
 
* smiles:
 
* smiles:
** cc(c)=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c1(=cc=cc=c1o))([o-])=o
 
* inchi-key:
 
* inchi-key:
** ifmyvrqehqtins-meoyllpmsa-j
+
** ygsdefsmjlzeoe-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 871.642
+
** 137.115
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11919]]
+
* [[SALICYLATE-1-MONOOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXNQT-4366]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2e)-5-methylhexa-2,4-dienoyl-coa}}
+
{{#set: common-name=salicylate}}
{{#set: inchi-key=inchikey=ifmyvrqehqtins-meoyllpmsa-j}}
+
{{#set: inchi-key=inchikey=ygsdefsmjlzeoe-uhfffaoysa-m}}
{{#set: molecular-weight=871.642}}
+
{{#set: molecular-weight=137.115}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-110

  • common-name:
    • salicylate
  • smiles:
    • c(c1(=cc=cc=c1o))([o-])=o
  • inchi-key:
    • ygsdefsmjlzeoe-uhfffaoysa-m
  • molecular-weight:
    • 137.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality