Difference between revisions of "PWY-2681"

Latest revision as of 10:57, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] ==
+== Pathway PWY-2681 ==
+* taxonomic-range:
+** tax-3193
 * common-name:
-** 3,7-dimethylurate
+** trans-zeatin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
+* [[RXN-4303]]
-* inchi-key:
+* [[RXN-4305]]
-** hmlzlhkhnblljd-uhfffaoysa-n
+* [[RXN-4307]]
-* molecular-weight:
+* [[RXN-4313]]
-** 196.165
+== Reaction(s) not found ==
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-4314 RXN-4314]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-4310 RXN-4310]
-* [[RXN-11519]]
+* [NoneRXN-4312 RXN-4312]
-== Reaction(s) of unknown directionality ==
+* [NoneRXN-4308 RXN-4308]
-{{#set: common-name=3,7-dimethylurate}}
+* [NoneRXN-4317 RXN-4317]
-{{#set: inchi-key=inchikey=hmlzlhkhnblljd-uhfffaoysa-n}}
+* [NoneRXN-4304 RXN-4304]
-{{#set: molecular-weight=196.165}}
+* [NoneRXN-4306 RXN-4306]
+{{#set: taxonomic-range=tax-3193}}
+{{#set: common-name=trans-zeatin biosynthesis}}
+{{#set: nb reaction found=4}}
+{{#set: completion rate=0.36}}
+{{#set: nb total reaction=11}}