Difference between revisions of "PWY-2681"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15362 CPD-15362] == * common-name: ** (2e,11z)-icosa-2,11-dienoyl-coa * smiles: ** cccccccc...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * common-name: ** l-gulonate * smiles: ** c(o)c(o)c(o)c(o)c(o)c(=o)[o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-gulonate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c(o)c(o)c(o)c(o)c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rghnjxzeokukbd-qtbdoelssa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 195.149 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[GLUCURONATE-REDUCTASE-RXN]] |
| + | * [[RXN-8783]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-gulonate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rghnjxzeokukbd-qtbdoelssa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=195.149}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite L-GULONATE
- common-name:
- l-gulonate
- smiles:
- c(o)c(o)c(o)c(o)c(o)c(=o)[o-]
- inchi-key:
- rghnjxzeokukbd-qtbdoelssa-m
- molecular-weight:
- 195.149
