Difference between revisions of "PWY-2681"

Revision as of 20:15, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] ==
+== Pathway PWY-5174 ==
+* taxonomic-range:
+** tax-58024
 * common-name:
-** 3,7-dimethylurate
+** capsanthin and capsorubin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cn1(c(=o)nc2(=c1c(=o)nc(=o)n(c)2))
+* [[RXN-7979]]
-* inchi-key:
+== Reaction(s) not found ==
-** hmlzlhkhnblljd-uhfffaoysa-n
+* [NoneRXN-7946 RXN-7946]
-* molecular-weight:
+* [NoneRXN-7947 RXN-7947]
-** 196.165
+{{#set: taxonomic-range=tax-58024}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=capsanthin and capsorubin biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-11519]]
+{{#set: completion rate=0.33}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=3}}
-{{#set: common-name=3,7-dimethylurate}}
-{{#set: inchi-key=inchikey=hmlzlhkhnblljd-uhfffaoysa-n}}
-{{#set: molecular-weight=196.165}}