Difference between revisions of "PWY-2723"

Revision as of 14:19, 26 August 2019

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19170 CPD-19170] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Uracil17-in-tRNAs Uracil17-in-tRNAs] ==
 * common-name:
-** (2e,7z)-hexadecenoyl-coa
+** a uracil17 in trna
-* smiles:
-** ccccccccc=ccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
-* inchi-key:
-** yqarrkbgbkpbcx-dvzfgldusa-j
-* molecular-weight:
-** 997.883
 == Reaction(s) known to consume the compound ==
-* [[RXN-17780]]
+* [[RXN-12455]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-17779]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=(2e,7z)-hexadecenoyl-coa}}
+{{#set: common-name=a uracil17 in trna}}
-{{#set: inchi-key=inchikey=yqarrkbgbkpbcx-dvzfgldusa-j}}
-{{#set: molecular-weight=997.883}}