Difference between revisions of "PWY-282"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE] ==
+== Pathway PWY-282 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
+** cuticular wax biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
+* [[RXNQT-4193]]
-* inchi-key:
+== Reaction(s) not found ==
-** yszsvgfmajxgmq-fricuitqsa-m
+* [NoneRXN-1022 RXN-1022]
-* molecular-weight:
+* [NoneRXNQT-4192 RXNQT-4192]
-** 575.85
+* [NoneRXN-1021 RXN-1021]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-1025 RXN-1025]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-1023 RXN-1023]
-* [[2.1.1.114-RXN]]
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=cuticular wax biosynthesis}}
-{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=yszsvgfmajxgmq-fricuitqsa-m}}
+{{#set: completion rate=0.17}}
-{{#set: molecular-weight=575.85}}
+{{#set: nb total reaction=6}}