Difference between revisions of "PWY-2902"

Latest revision as of 11:00, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-METHYL-6-SOLANYL-14-BENZOQUINONE 2-METHYL-6-SOLANYL-14-BENZOQUINONE] ==
+== Pathway PWY-2902 ==
+* taxonomic-range:
+** tax-3193
 * common-name:
-** 2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol
+** cytokinin-o-glucosides biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=cccc(c)=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(=cccc(=ccc1(=c(o)c(c)=cc(o)=c1))c)c)c)c
+* [[RXN-4726]]
-* inchi-key:
+== Reaction(s) not found ==
-** swkaczqjgxabcn-jsgwljpksa-n
+* [NoneRXN-4735 RXN-4735]
-* molecular-weight:
+* [NoneRXN-4737 RXN-4737]
-** 737.203
+* [NoneRXN-4723 RXN-4723]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-3193}}
-* [[RXN-2762]]
+{{#set: common-name=cytokinin-o-glucosides biosynthesis}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=1}}
-* [[RXN-2761]]
+{{#set: completion rate=0.25}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb total reaction=4}}
-{{#set: common-name=2-methyl-6-all-trans-nonaprenyl-1,4-benzoquinol}}
-{{#set: inchi-key=inchikey=swkaczqjgxabcn-jsgwljpksa-n}}
-{{#set: molecular-weight=737.203}}