Difference between revisions of "PWY-2941"

Revision as of 20:17, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12199 CPD-12199] ==
+== Pathway PWY-7863 ==
+* taxonomic-range:
+** tax-201174
 * common-name:
-** 3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa
+** roseoflavin biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(o)c1(=cc=c(o)c=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+* [[RIBOFLAVINKIN-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** vddfxumtxcqmfm-ugdqnksbsa-j
+* [NoneRXN-18508 RXN-18508]
-* molecular-weight:
+* [NoneRXN-18507 RXN-18507]
-** 927.663
+* [NoneRXN-18506 RXN-18506]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-18509 RXN-18509]
-* [[RXN-11245]]
+* [NoneRXN-18504 RXN-18504]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-18505 RXN-18505]
-* [[RXN-11244]]
+{{#set: taxonomic-range=tax-201174}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=roseoflavin biosynthesis}}
-{{#set: common-name=3s-(4-hydroxyphenyl)-3-hydroxy-propanoyl-coa}}
+{{#set: nb reaction found=1}}
-{{#set: inchi-key=inchikey=vddfxumtxcqmfm-ugdqnksbsa-j}}
+{{#set: completion rate=0.14}}
-{{#set: molecular-weight=927.663}}
+{{#set: nb total reaction=7}}