Difference between revisions of "PWY-2942"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6N6N6-TRIMETHYL-L-LYSINE N6N6N6-TRIMETHYL-L-LYSINE] == * common-name: ** n6,n6,n6-trimethyl-l-...")
(Created page with "Category:pathway == Pathway PWY-2942 == * taxonomic-range: ** tax-2 * common-name: ** l-lysine biosynthesis iii == Reaction(s) found == * ASPARTATE-SEMIALDEHYDE-DEHYDROG...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6N6N6-TRIMETHYL-L-LYSINE N6N6N6-TRIMETHYL-L-LYSINE] ==
+
== Pathway PWY-2942 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** n6,n6,n6-trimethyl-l-lysine
+
** l-lysine biosynthesis iii
* smiles:
+
== Reaction(s) found ==
** c[n+](ccccc(c([o-])=o)[n+])(c)c
+
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
* inchi-key:
+
* [[ASPARTATEKIN-RXN]]
** mxnrlfusfkvqsk-qmmmgpobsa-o
+
* [[DIAMINOPIMDECARB-RXN]]
* molecular-weight:
+
* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
** 189.277
+
* [[DIHYDRODIPICSYN-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[RXN-14014]]
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-4821 RXN-4821]
== Reaction(s) of unknown directionality ==
+
{{#set: taxonomic-range=tax-2}}
{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
+
{{#set: common-name=l-lysine biosynthesis iii}}
{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
+
{{#set: nb reaction found=6}}
{{#set: molecular-weight=189.277}}
+
{{#set: completion rate=0.86}}
 +
{{#set: nb total reaction=7}}

Latest revision as of 10:57, 18 March 2021

Pathway PWY-2942

  • taxonomic-range:
    • tax-2
  • common-name:
    • l-lysine biosynthesis iii

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-4821 RXN-4821]