Difference between revisions of "PWY-2942"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] == * common-name: ** 3r-hydroxy-lesqueroloyl-coa * smiles: ** ccccccc(o)cc...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6N6N6-TRIMETHYL-L-LYSINE N6N6N6-TRIMETHYL-L-LYSINE] == * common-name: ** n6,n6,n6-trimethyl-l-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15369 CPD-15369] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6N6N6-TRIMETHYL-L-LYSINE N6N6N6-TRIMETHYL-L-LYSINE] ==
 
* common-name:
 
* common-name:
** 3r-hydroxy-lesqueroloyl-coa
+
** n6,n6,n6-trimethyl-l-lysine
 
* smiles:
 
* smiles:
** ccccccc(o)cc=ccccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
+
** c[n+](ccccc(c([o-])=o)[n+])(c)c
 
* inchi-key:
 
* inchi-key:
** chmqnmkvoyfhhx-sgpqcwjrsa-j
+
** mxnrlfusfkvqsk-qmmmgpobsa-o
 
* molecular-weight:
 
* molecular-weight:
** 1088.005
+
** 189.277
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14494]]
+
* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14493]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3r-hydroxy-lesqueroloyl-coa}}
+
{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
{{#set: inchi-key=inchikey=chmqnmkvoyfhhx-sgpqcwjrsa-j}}
+
{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
{{#set: molecular-weight=1088.005}}
+
{{#set: molecular-weight=189.277}}

Revision as of 09:22, 27 August 2019

Metabolite N6N6N6-TRIMETHYL-L-LYSINE

  • common-name:
    • n6,n6,n6-trimethyl-l-lysine
  • smiles:
    • c[n+](ccccc(c([o-])=o)[n+])(c)c
  • inchi-key:
    • mxnrlfusfkvqsk-qmmmgpobsa-o
  • molecular-weight:
    • 189.277

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality