Difference between revisions of "PWY-2942"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N6N6N6-TRIMETHYL-L-LYSINE N6N6N6-TRIMETHYL-L-LYSINE] ==
+== Pathway PWY-2942 ==
+* taxonomic-range:
+** tax-2
 * common-name:
-** n6,n6,n6-trimethyl-l-lysine
+** l-lysine biosynthesis iii
-* smiles:
+== Reaction(s) found ==
-** c[n+](ccccc(c([o-])=o)[n+])(c)c
+* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
-* inchi-key:
+* [[ASPARTATEKIN-RXN]]
-** mxnrlfusfkvqsk-qmmmgpobsa-o
+* [[DIAMINOPIMDECARB-RXN]]
-* molecular-weight:
+* [[DIAMINOPIMELATE-DEHYDROGENASE-RXN]]
-** 189.277
+* [[DIHYDRODIPICSYN-RXN]]
-== Reaction(s) known to consume the compound ==
+* [[RXN-14014]]
-* [[TRIMETHYLLYSINE-DIOXYGENASE-RXN]]
+== Reaction(s) not found ==
-== Reaction(s) known to produce the compound ==
+* [NoneRXN-4821 RXN-4821]
-== Reaction(s) of unknown directionality ==
+{{#set: taxonomic-range=tax-2}}
-{{#set: common-name=n6,n6,n6-trimethyl-l-lysine}}
+{{#set: common-name=l-lysine biosynthesis iii}}
-{{#set: inchi-key=inchikey=mxnrlfusfkvqsk-qmmmgpobsa-o}}
+{{#set: nb reaction found=6}}
-{{#set: molecular-weight=189.277}}
+{{#set: completion rate=0.86}}
+{{#set: nb total reaction=7}}