Difference between revisions of "PWY-31"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-678 CPD-678] == * common-name: ** hydrogen selenide * smiles: ** [seh2] * inchi-key: ** spv...") |
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-histidinol phosphate |
* smiles: | * smiles: | ||
| − | ** [ | + | ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cwnderhthmwbsi-yfkpbyrvsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 220.144 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[HISTAMINOTRANS-RXN]] |
| + | * [[HISTIDPHOS-RXN]] | ||
| + | * [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[HISTAMINOTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-histidinol phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=220.144}} |
Revision as of 14:18, 26 August 2019
Contents
Metabolite L-HISTIDINOL-P
- common-name:
- l-histidinol phosphate
- smiles:
- c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
- inchi-key:
- cwnderhthmwbsi-yfkpbyrvsa-m
- molecular-weight:
- 220.144
Reaction(s) known to consume the compound
- HISTAMINOTRANS-RXN
- HISTIDPHOS-RXN
- [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
