Difference between revisions of "PWY-31"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=n...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] == * common-name: ** (3e)-undec-3-enoyl-coa * smiles: ** cccccccc=ccc(=o)s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-HISTIDINOL-P L-HISTIDINOL-P] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15655 CPD-15655] ==
 
* common-name:
 
* common-name:
** l-histidinol phosphate
+
** (3e)-undec-3-enoyl-coa
 
* smiles:
 
* smiles:
** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
+
** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** cwnderhthmwbsi-yfkpbyrvsa-m
+
** hvxccjiyxizgop-nadloitosa-j
 
* molecular-weight:
 
* molecular-weight:
** 220.144
+
** 929.765
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTAMINOTRANS-RXN]]
 
* [[HISTIDPHOS-RXN]]
 
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[RXN-14776]]
 +
* [[RXN-14790]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-histidinol phosphate}}
+
{{#set: common-name=(3e)-undec-3-enoyl-coa}}
{{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}}
+
{{#set: inchi-key=inchikey=hvxccjiyxizgop-nadloitosa-j}}
{{#set: molecular-weight=220.144}}
+
{{#set: molecular-weight=929.765}}

Revision as of 09:22, 27 August 2019

Metabolite CPD-15655

  • common-name:
    • (3e)-undec-3-enoyl-coa
  • smiles:
    • cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • hvxccjiyxizgop-nadloitosa-j
  • molecular-weight:
    • 929.765

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality