Difference between revisions of "PWY-3161"

Revision as of 20:16, 18 December 2020

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6701 CPD-6701] ==
+== Pathway PWY-2261 ==
+* taxonomic-range:
+** tax-33682
+** tax-33090
+** tax-1117
 * common-name:
-** 1d-myo-inositol 5-monophosphate
+** ascorbate glutathione cycle
-* smiles:
+== Reaction(s) found ==
-** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
+* [[1.8.5.1-RXN]]
-* inchi-key:
+* [[RXN-3521]]
-** inapmgsxuvuwaf-kxxvrosksa-l
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-3523 RXN-3523]
-** 258.121
+* [NoneRXN-3522 RXN-3522]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-33682|tax-33090|tax-1117}}
-* [[RXN-10953]]
+{{#set: common-name=ascorbate glutathione cycle}}
-== Reaction(s) known to produce the compound ==
+{{#set: nb reaction found=2}}
-== Reaction(s) of unknown directionality ==
+{{#set: completion rate=0.5}}
-{{#set: common-name=1d-myo-inositol 5-monophosphate}}
+{{#set: nb total reaction=4}}
-{{#set: inchi-key=inchikey=inapmgsxuvuwaf-kxxvrosksa-l}}
-{{#set: molecular-weight=258.121}}