Difference between revisions of "PWY-3181"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * common-name: ** p-nitrophenyl-α-d-galactopyranoside * smiles: *...")
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-carbo-me-ami-me-ur-34-tRNALeu 5-carbo-me-ami-me-ur-34-tRNALeu] == * common-name: ** a 5-carbo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-carbo-me-ami-me-ur-34-tRNALeu 5-carbo-me-ami-me-ur-34-tRNALeu] ==
 
* common-name:
 
* common-name:
** p-nitrophenyl-α-d-galactopyranoside
+
** a 5-carboxymethylaminomethyluridine34 in trnaleu
* smiles:
 
** c(o)c2(c(o)c(o)c(o)c(oc1(c=cc(=cc=1)[n+]([o-])=o))o2)
 
* inchi-key:
 
** ifbhrqdfsncloz-iirvcbmxsa-n
 
* molecular-weight:
 
** 301.252
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17830]]
+
* [[RXN-11865]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=p-nitrophenyl-α-d-galactopyranoside}}
+
{{#set: common-name=a 5-carboxymethylaminomethyluridine34 in trnaleu}}
{{#set: inchi-key=inchikey=ifbhrqdfsncloz-iirvcbmxsa-n}}
 
{{#set: molecular-weight=301.252}}
 

Revision as of 09:22, 27 August 2019

Metabolite 5-carbo-me-ami-me-ur-34-tRNALeu

  • common-name:
    • a 5-carboxymethylaminomethyluridine34 in trnaleu

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality