Difference between revisions of "PWY-321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op...")
(Created page with "Category:pathway == Pathway PWY-321 == * taxonomic-range: ** tax-33090 * common-name: ** cutin biosynthesis == Reaction(s) found == * PALMITOYL-COA-HYDROLASE-RXN * R...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] ==
+
== Pathway PWY-321 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** datp
+
** cutin biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
+
* [[PALMITOYL-COA-HYDROLASE-RXN]]
* inchi-key:
+
* [[RXN-16389]]
** suyvubyjarfzho-rrkcrqdmsa-j
+
* [[RXN-9666]]
* molecular-weight:
+
== Reaction(s) not found ==
** 487.152
+
* [NoneRXN-16400 RXN-16400]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-9804 RXN-9804]
* [[DATCY]]
+
* [NoneRXN-1062 RXN-1062]
* [[DATPtm]]
+
* [NoneRXN-16416 RXN-16416]
* [[DATUP]]
+
* [NoneRXN-16417 RXN-16417]
* [[RXN-14195]]
+
* [NoneRXN-9802 RXN-9802]
* [[RXN-14214]]
+
* [NoneRXN-9803 RXN-9803]
* [[RXN0-384]]
+
* [NoneRXN-16398 RXN-16398]
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-9806 RXN-9806]
* [[DADPKIN-RXN]]
+
* [NoneRXN-1064 RXN-1064]
* [[DATPtm]]
+
* [NoneRXN-9807 RXN-9807]
* [[NDPK]]
+
* [NoneRXN-9805 RXN-9805]
* [[NDPKm]]
+
* [NoneRXN-1065 RXN-1065]
* [[RXN-14192]]
+
{{#set: taxonomic-range=tax-33090}}
* [[RXN0-745]]
+
{{#set: common-name=cutin biosynthesis}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=3}}
{{#set: common-name=datp}}
+
{{#set: completion rate=0.19}}
{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}
+
{{#set: nb total reaction=16}}
{{#set: molecular-weight=487.152}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-321

  • taxonomic-range:
    • tax-33090
  • common-name:
    • cutin biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-16400 RXN-16400]
  • [NoneRXN-9804 RXN-9804]
  • [NoneRXN-1062 RXN-1062]
  • [NoneRXN-16416 RXN-16416]
  • [NoneRXN-16417 RXN-16417]
  • [NoneRXN-9802 RXN-9802]
  • [NoneRXN-9803 RXN-9803]
  • [NoneRXN-16398 RXN-16398]
  • [NoneRXN-9806 RXN-9806]
  • [NoneRXN-1064 RXN-1064]
  • [NoneRXN-9807 RXN-9807]
  • [NoneRXN-9805 RXN-9805]
  • [NoneRXN-1065 RXN-1065]