Difference between revisions of "PWY-321"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] == * common-name: ** datp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op...")
(Created page with "Category:pathway == Pathway PWY-7782 == * taxonomic-range: ** tax-33208 * common-name: ** plasmalogen biosynthesis == Reaction(s) found == * 2.3.1.42-RXN * 2.7.7.14-...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DATP DATP] ==
+
== Pathway PWY-7782 ==
 +
* taxonomic-range:
 +
** tax-33208
 
* common-name:
 
* common-name:
** datp
+
** plasmalogen biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op(op([o-])(=o)[o-])([o-])=o)([o-])=o
+
* [[2.3.1.42-RXN]]
* inchi-key:
+
* [[2.7.7.14-RXN]]
** suyvubyjarfzho-rrkcrqdmsa-j
+
* [[2.7.7.15-RXN]]
* molecular-weight:
+
* [[ALKYLGLYCERONE-PHOSPHATE-SYNTHASE-RXN]]
** 487.152
+
* [[CHOLINE-KINASE-RXN]]
== Reaction(s) known to consume the compound ==
+
* [[ETHANOLAMINE-KINASE-RXN]]
* [[DATCY]]
+
* [[RXN-17728]]
* [[DATPtm]]
+
* [[RXN-17729]]
* [[DATUP]]
+
* [[RXN-17730]]
* [[RXN-14195]]
+
* [[RXN-17731]]
* [[RXN-14214]]
+
* [[RXN-17733]]
* [[RXN0-384]]
+
== Reaction(s) not found ==
== Reaction(s) known to produce the compound ==
+
* [NoneRXN-9344 RXN-9344]
* [[DADPKIN-RXN]]
+
* [NoneRXN-5641 RXN-5641]
* [[DATPtm]]
+
* [NoneRXN-17732 RXN-17732]
* [[NDPK]]
+
* [NoneRXN-17734 RXN-17734]
* [[NDPKm]]
+
* [None2.7.8.22-RXN 2.7.8.22-RXN]
* [[RXN-14192]]
+
{{#set: taxonomic-range=tax-33208}}
* [[RXN0-745]]
+
{{#set: common-name=plasmalogen biosynthesis}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb reaction found=11}}
{{#set: common-name=datp}}
+
{{#set: completion rate=0.69}}
{{#set: inchi-key=inchikey=suyvubyjarfzho-rrkcrqdmsa-j}}
+
{{#set: nb total reaction=16}}
{{#set: molecular-weight=487.152}}
 

Revision as of 20:18, 18 December 2020

Pathway PWY-7782

  • taxonomic-range:
    • tax-33208
  • common-name:
    • plasmalogen biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-9344 RXN-9344]
  • [NoneRXN-5641 RXN-5641]
  • [NoneRXN-17732 RXN-17732]
  • [NoneRXN-17734 RXN-17734]
  • [None2.7.8.22-RXN 2.7.8.22-RXN]